C10H9BrF2N2O2 — CID 86810728
1-(4-bromo-2-nitrophenyl)-3,3-difluoropyrrolidine (PubChem CID 86810728) has the molecular formula C10H9BrF2N2O2 and a molecular weight of 307.09 g/mol. Its IUPAC name is 1-(4-bromo-2-nitrophenyl)-3,3-difluoropyrrolidine.
| Compound Name | 1-(4-bromo-2-nitrophenyl)-3,3-difluoropyrrolidine |
|---|---|
| PubChem CID | 86810728 |
| Molecular Formula | C10H9BrF2N2O2 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 1-(4-bromo-2-nitrophenyl)-3,3-difluoropyrrolidine |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H9BrF2N2O2/c11-7-1-2-8(9(5-7)15(16)17)14-4-3-10(12,13)6-14/h1-2,5H,3-4,6H2 |
| InChIKey | RORPZWVEWUAWDQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|