C11H11F3N2O2 — CID 86810649
3,3-difluoro-1-(4-fluoro-2-nitrophenyl)piperidine (PubChem CID 86810649) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 3,3-difluoro-1-(4-fluoro-2-nitrophenyl)piperidine.
| Compound Name | 3,3-difluoro-1-(4-fluoro-2-nitrophenyl)piperidine |
|---|---|
| PubChem CID | 86810649 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3,3-difluoro-1-(4-fluoro-2-nitrophenyl)piperidine |
| SMILES | O=[N+]([O-])c1cc(F)ccc1N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-8-2-3-9(10(6-8)16(17)18)15-5-1-4-11(13,14)7-15/h2-3,6H,1,4-5,7H2 |
| InChIKey | CKSXOERKNDLLCZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|