C25H28F2N4O8 — CID 87433394
4-(3,3-difluoropiperidin-1-yl)-3-nitrobenzoic acid;4-(2-methylpiperidin-1-yl)-3-nitrobenzoic acid (PubChem CID 87433394) has the molecular formula C25H28F2N4O8 and a molecular weight of 550.52 g/mol. Its IUPAC name is 4-(3,3-difluoropiperidin-1-yl)-3-nitrobenzoic acid;4-(2-methylpiperidin-1-yl)-3-nitrobenzoic acid.
| Compound Name | 4-(3,3-difluoropiperidin-1-yl)-3-nitrobenzoic acid;4-(2-methylpiperidin-1-yl)-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 87433394 |
| Molecular Formula | C25H28F2N4O8 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 4-(3,3-difluoropiperidin-1-yl)-3-nitrobenzoic acid;4-(2-methylpiperidin-1-yl)-3-nitrobenzoic acid |
| SMILES | CC1CCCCN1c1ccc(C(=O)O)cc1[N+](=O)[O-].O=C(O)c1ccc(N2CCCC(F)(F)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O4.C12H12F2N2O4/c1-9-4-2-3-7-14(9)11-6-5-10(13(16)17)8-12(11)15(18)19;13-12(14)4-1-5-15(7-12)9-3-2-8(11(17)18)6-10(9)16(19)20/h5-6,8-9H,2-4,7H2,1H3,(H,16,17);2-3,6H,1,4-5,7H2,(H,17,18) |
| InChIKey | RGXZDBCBRKHPOH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|