4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid

C12H12F3NO2 — CID 138986330

IUPAC4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid
SMILESO=C(O)c1ccc(N2CCCC(F)(F)C2)c(F)c1
InChIInChI=1S/C12H12F3NO2/c13-9-6-8(11(17)18)2-3-10(9)16-5-1-4-12(14,15)7-16/h2-3,6H,1,4-5,7H2,(H,17,18)
InChIKeyUPPWMKRDHLUTMG-UHFFFAOYSA-N
MW259.23 g/mol
LogP2.76
Rot. Bonds2

About 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid

4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid (PubChem CID 138986330) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid.

Molecular Properties

Compound Name4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid
PubChem CID138986330
Molecular FormulaC12H12F3NO2
Molecular Weight259.23 g/mol
Exact Mass259.08
IUPAC Name4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid
SMILESO=C(O)c1ccc(N2CCCC(F)(F)C2)c(F)c1
InChIInChI=1S/C12H12F3NO2/c13-9-6-8(11(17)18)2-3-10(9)16-5-1-4-12(14,15)7-16/h2-3,6H,1,4-5,7H2,(H,17,18)
InChIKeyUPPWMKRDHLUTMG-UHFFFAOYSA-N
XLogP2.76
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.23
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid?
The IUPAC name of 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid (CID 138986330) is 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid.
What is the SMILES notation for 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid?
The canonical SMILES for 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid is O=C(O)c1ccc(N2CCCC(F)(F)C2)c(F)c1.
What is the InChIKey of 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid?
The InChIKey is UPPWMKRDHLUTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO2/c13-9-6-8(11(17)18)2-3-10(9)16-5-1-4-12(14,15)7-16/h2-3,6H,1,4-5,7H2,(H,17,18).
What are the key properties of 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid?
4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid has a molecular weight of 259.23 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzoic acid is sourced from PubChem (CID 138986330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).