C14H17FN2O6 — CID 175884079
methyl 4-fluoro-5-[3-(2-hydroxyethyl)morpholin-4-yl]-2-nitrobenzoate (PubChem CID 175884079) has the molecular formula C14H17FN2O6 and a molecular weight of 328.30 g/mol. Its IUPAC name is methyl 4-fluoro-5-[3-(2-hydroxyethyl)morpholin-4-yl]-2-nitrobenzoate.
| Compound Name | methyl 4-fluoro-5-[3-(2-hydroxyethyl)morpholin-4-yl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 175884079 |
| Molecular Formula | C14H17FN2O6 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 4-fluoro-5-[3-(2-hydroxyethyl)morpholin-4-yl]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(N2CCOCC2CCO)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17FN2O6/c1-22-14(19)10-6-13(11(15)7-12(10)17(20)21)16-3-5-23-8-9(16)2-4-18/h6-7,9,18H,2-5,8H2,1H3 |
| InChIKey | CRVGTIJPSDXOTB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|