C20H27N3O7 — CID 175884049
tert-butyl 4-(2-ethenyl-5-methoxycarbonyl-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 175884049) has the molecular formula C20H27N3O7 and a molecular weight of 421.45 g/mol. Its IUPAC name is tert-butyl 4-(2-ethenyl-5-methoxycarbonyl-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-ethenyl-5-methoxycarbonyl-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175884049 |
| Molecular Formula | C20H27N3O7 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | tert-butyl 4-(2-ethenyl-5-methoxycarbonyl-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | C=Cc1cc([N+](=O)[O-])c(C(=O)OC)cc1N1CCN(C(=O)OC(C)(C)C)CC1CO |
| InChI | InChI=1S/C20H27N3O7/c1-6-13-9-17(23(27)28)15(18(25)29-5)10-16(13)22-8-7-21(11-14(22)12-24)19(26)30-20(2,3)4/h6,9-10,14,24H,1,7-8,11-12H2,2-5H3 |
| InChIKey | LKFQRXNUMSHOEH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|