C16H20BrN5O5 — CID 171095296
tert-butyl (3R)-4-(3-bromo-4-cyano-5-nitro-2-pyridinyl)-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 171095296) has the molecular formula C16H20BrN5O5 and a molecular weight of 442.27 g/mol. Its IUPAC name is tert-butyl (3R)-4-(3-bromo-4-cyano-5-nitro-2-pyridinyl)-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(3-bromo-4-cyano-5-nitro-2-pyridinyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171095296 |
| Molecular Formula | C16H20BrN5O5 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | tert-butyl (3R)-4-(3-bromo-4-cyano-5-nitro-2-pyridinyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc([N+](=O)[O-])c(C#N)c2Br)[C@@H](CO)C1 |
| InChI | InChI=1S/C16H20BrN5O5/c1-16(2,3)27-15(24)20-4-5-21(10(8-20)9-23)14-13(17)11(6-18)12(7-19-14)22(25)26/h7,10,23H,4-5,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | DCLBVLPRRPXODB-SNVBAGLBSA-N |
| XLogP | 2.04 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|