C22H32N4O5 — CID 145479656
tert-butyl 3-(methoxymethyl)-4-(5-nitroisoquinolin-1-yl)piperazine-1-carboxylate;ethane (PubChem CID 145479656) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl 3-(methoxymethyl)-4-(5-nitroisoquinolin-1-yl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(methoxymethyl)-4-(5-nitroisoquinolin-1-yl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145479656 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl 3-(methoxymethyl)-4-(5-nitroisoquinolin-1-yl)piperazine-1-carboxylate;ethane |
| SMILES | CC.COCC1CN(C(=O)OC(C)(C)C)CCN1c1nccc2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C20H26N4O5.C2H6/c1-20(2,3)29-19(25)22-10-11-23(14(12-22)13-28-4)18-16-6-5-7-17(24(26)27)15(16)8-9-21-18;1-2/h5-9,14H,10-13H2,1-4H3;1-2H3 |
| InChIKey | ADEAJQPVKPBEIJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|