C16H20FN3O6 — CID 171061956
1-(2-fluoro-6-nitrophenyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (PubChem CID 171061956) has the molecular formula C16H20FN3O6 and a molecular weight of 369.35 g/mol. Its IUPAC name is 1-(2-fluoro-6-nitrophenyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid.
| Compound Name | 1-(2-fluoro-6-nitrophenyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 171061956 |
| Molecular Formula | C16H20FN3O6 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(2-fluoro-6-nitrophenyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(F)cccc2[N+](=O)[O-])C(C(=O)O)C1 |
| InChI | InChI=1S/C16H20FN3O6/c1-16(2,3)26-15(23)18-7-8-19(12(9-18)14(21)22)13-10(17)5-4-6-11(13)20(24)25/h4-6,12H,7-9H2,1-3H3,(H,21,22) |
| InChIKey | NGJSBNVYWWTBGS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|