C14H18N2O4 — CID 73013087
tert-butyl 8-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 73013087) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is tert-butyl 8-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 8-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 73013087 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | tert-butyl 8-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cccc([N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2,3)20-13(17)15-8-7-10-5-4-6-12(16(18)19)11(10)9-15/h4-6H,7-9H2,1-3H3 |
| InChIKey | BRIXBAIBMFETOH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|