C14H17IN2O4 — CID 142617477
tert-butyl 5-iodo-7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 142617477) has the molecular formula C14H17IN2O4 and a molecular weight of 404.20 g/mol. Its IUPAC name is tert-butyl 5-iodo-7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 5-iodo-7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 142617477 |
| Molecular Formula | C14H17IN2O4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | tert-butyl 5-iodo-7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(I)cc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C14H17IN2O4/c1-14(2,3)21-13(18)16-5-4-11-9(8-16)6-10(17(19)20)7-12(11)15/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | VBILXCWPEBXEJI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|