C16H24N2O2 — CID 167387612
tert-butyl 6-amino-5,7-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 167387612) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is tert-butyl 6-amino-5,7-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 6-amino-5,7-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 167387612 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | tert-butyl 6-amino-5,7-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | Cc1cc2c(c(C)c1N)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H24N2O2/c1-10-8-12-9-18(15(19)20-16(3,4)5)7-6-13(12)11(2)14(10)17/h8H,6-7,9,17H2,1-5H3 |
| InChIKey | RQVANWMXPYFCBU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|