C19H25NO4 — CID 170083787
2-O-tert-butyl 7-O-methyl 5-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate (PubChem CID 170083787) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-O-tert-butyl 7-O-methyl 5-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate.
| Compound Name | 2-O-tert-butyl 7-O-methyl 5-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate |
|---|---|
| PubChem CID | 170083787 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-O-tert-butyl 7-O-methyl 5-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate |
| SMILES | C=CCc1cc(C(=O)OC)cc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C19H25NO4/c1-6-7-13-10-14(17(21)23-5)11-15-12-20(9-8-16(13)15)18(22)24-19(2,3)4/h6,10-11H,1,7-9,12H2,2-5H3 |
| InChIKey | HGYLQIADDNWQPH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|