C33H46N4O11 — CID 161170111
tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate;7-nitro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 161170111) has the molecular formula C33H46N4O11 and a molecular weight of 674.75 g/mol. Its IUPAC name is tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate;7-nitro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate;7-nitro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 161170111 |
| Molecular Formula | C33H46N4O11 |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 7-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate;7-nitro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc([N+](=O)[O-])cc2C1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=[N+]([O-])c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C14H18N2O4.C10H18O5.C9H10N2O2/c1-14(2,3)20-13(17)15-7-6-10-4-5-12(16(18)19)8-11(10)9-15;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;12-11(13)9-2-1-7-3-4-10-6-8(7)5-9/h4-5,8H,6-7,9H2,1-3H3;1-6H3;1-2,5,10H,3-4,6H2 |
| InChIKey | URBKNOAOXFHEJG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 189.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|