C11H12N2O3 — CID 6425473
1-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone (PubChem CID 6425473) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone.
| Compound Name | 1-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 6425473 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
| SMILES | CC(=O)N1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C11H12N2O3/c1-8(14)12-5-4-9-2-3-11(13(15)16)6-10(9)7-12/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | BKJRHIYYEKJYTP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|