C11H15BN2O3 — CID 149140996
methyl-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)borinic acid (PubChem CID 149140996) has the molecular formula C11H15BN2O3 and a molecular weight of 234.06 g/mol. Its IUPAC name is methyl-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)borinic acid.
| Compound Name | methyl-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)borinic acid |
|---|---|
| PubChem CID | 149140996 |
| Molecular Formula | C11H15BN2O3 |
| Molecular Weight | 234.06 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | methyl-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)borinic acid |
| SMILES | CB(O)N1CCc2ccc([N+](=O)[O-])cc2CC1 |
| InChI | InChI=1S/C11H15BN2O3/c1-12(15)13-6-4-9-2-3-11(14(16)17)8-10(9)5-7-13/h2-3,8,15H,4-7H2,1H3 |
| InChIKey | ZJWAVDPBRODKBQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.06 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|