C9H10N2O4S — CID 2918213
1-methylsulfonyl-5-nitro-2,3-dihydroindole (PubChem CID 2918213) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is 1-methylsulfonyl-5-nitro-2,3-dihydroindole.
| Compound Name | 1-methylsulfonyl-5-nitro-2,3-dihydroindole |
|---|---|
| PubChem CID | 2918213 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1-methylsulfonyl-5-nitro-2,3-dihydroindole |
| SMILES | CS(=O)(=O)N1CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C9H10N2O4S/c1-16(14,15)10-5-4-7-6-8(11(12)13)2-3-9(7)10/h2-3,6H,4-5H2,1H3 |
| InChIKey | NRBRMCAQIDGPNX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|