C17H17N3O5S — CID 51200214
N-(4-methyl-3-nitrophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide (PubChem CID 51200214) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-(4-methyl-3-nitrophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-(4-methyl-3-nitrophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 51200214 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(4-methyl-3-nitrophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)CCN3S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O5S/c1-11-3-5-14(10-16(11)20(22)23)18-17(21)13-4-6-15-12(9-13)7-8-19(15)26(2,24)25/h3-6,9-10H,7-8H2,1-2H3,(H,18,21) |
| InChIKey | VMMSHHZFNGORBE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|