C16H14F2N2O3S — CID 112506190
3,4-difluoro-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)benzamide (PubChem CID 112506190) has the molecular formula C16H14F2N2O3S and a molecular weight of 352.36 g/mol. Its IUPAC name is 3,4-difluoro-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)benzamide.
| Compound Name | 3,4-difluoro-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)benzamide |
|---|---|
| PubChem CID | 112506190 |
| Molecular Formula | C16H14F2N2O3S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3,4-difluoro-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)benzamide |
| SMILES | CS(=O)(=O)N1CCc2cc(NC(=O)c3ccc(F)c(F)c3)ccc21 |
| InChI | InChI=1S/C16H14F2N2O3S/c1-24(22,23)20-7-6-10-8-12(3-5-15(10)20)19-16(21)11-2-4-13(17)14(18)9-11/h2-5,8-9H,6-7H2,1H3,(H,19,21) |
| InChIKey | JCCSYJNBUSSAFL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |