C20H24N2O3S — CID 18776410
N-(4-tert-butylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide (PubChem CID 18776410) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 18776410 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccc3c(c2)CCN3S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-20(2,3)16-6-8-17(9-7-16)21-19(23)15-5-10-18-14(13-15)11-12-22(18)26(4,24)25/h5-10,13H,11-12H2,1-4H3,(H,21,23) |
| InChIKey | YAVGXLXNLNXNET-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |