C16H15FN2O3S — CID 2987467
N-(3-fluorophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide (PubChem CID 2987467) has the molecular formula C16H15FN2O3S and a molecular weight of 334.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-(3-fluorophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 2987467 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-(3-fluorophenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CCc2cc(C(=O)Nc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C16H15FN2O3S/c1-23(21,22)19-8-7-11-9-12(5-6-15(11)19)16(20)18-14-4-2-3-13(17)10-14/h2-6,9-10H,7-8H2,1H3,(H,18,20) |
| InChIKey | GVPUZGIMQAGYKP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |