C16H17N3O6S2 — CID 71908716
N-methyl-1-[(3-nitrophenyl)methylsulfonyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 71908716) has the molecular formula C16H17N3O6S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-methyl-1-[(3-nitrophenyl)methylsulfonyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-methyl-1-[(3-nitrophenyl)methylsulfonyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 71908716 |
| Molecular Formula | C16H17N3O6S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-methyl-1-[(3-nitrophenyl)methylsulfonyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CCN2S(=O)(=O)Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17N3O6S2/c1-17-27(24,25)15-5-6-16-13(10-15)7-8-18(16)26(22,23)11-12-3-2-4-14(9-12)19(20)21/h2-6,9-10,17H,7-8,11H2,1H3 |
| InChIKey | YENKOMVKRHOKKN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|