C17H17NO4S — CID 47019071
methyl 1-benzylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 47019071) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is methyl 1-benzylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 1-benzylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 47019071 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | methyl 1-benzylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCN2S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H17NO4S/c1-22-17(19)15-7-8-16-14(11-15)9-10-18(16)23(20,21)12-13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | CZRLLISVFNZDHW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |