C18H19NO4S — CID 46778180
methyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)benzoate (PubChem CID 46778180) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is methyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)benzoate.
| Compound Name | methyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 46778180 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-23-18(20)16-8-6-14(7-9-16)13-24(21,22)19-11-10-15-4-2-3-5-17(15)12-19/h2-9H,10-13H2,1H3 |
| InChIKey | BCAWKRAWMCGGOI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |