C11H15NO2S — CID 896528
2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 896528) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 896528 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCS(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C11H15NO2S/c1-2-15(13,14)12-8-7-10-5-3-4-6-11(10)9-12/h3-6H,2,7-9H2,1H3 |
| InChIKey | KGEJNOKRQODGQH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |