C15H24N2O2S — CID 67015451
6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)hexan-1-amine (PubChem CID 67015451) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)hexan-1-amine.
| Compound Name | 6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)hexan-1-amine |
|---|---|
| PubChem CID | 67015451 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)hexan-1-amine |
| SMILES | NCCCCCCS(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H24N2O2S/c16-10-5-1-2-6-12-20(18,19)17-11-9-14-7-3-4-8-15(14)13-17/h3-4,7-8H,1-2,5-6,9-13,16H2 |
| InChIKey | FNOZFLJRQWMKCG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|