C19H20F2N2O3S — CID 27377352
N-[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)propyl]-3,4-difluorobenzamide (PubChem CID 27377352) has the molecular formula C19H20F2N2O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)propyl]-3,4-difluorobenzamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)propyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 27377352 |
| Molecular Formula | C19H20F2N2O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)propyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCCCS(=O)(=O)N1CCc2ccccc2C1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H20F2N2O3S/c20-17-7-6-15(12-18(17)21)19(24)22-9-3-11-27(25,26)23-10-8-14-4-1-2-5-16(14)13-23/h1-2,4-7,12H,3,8-11,13H2,(H,22,24) |
| InChIKey | NKKRUCASVAHWIH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|