C13H16F2N2O3S — CID 110345378
3,4-difluoro-N-(2-pyrrolidin-1-ylsulfonylethyl)benzamide (PubChem CID 110345378) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.34 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-pyrrolidin-1-ylsulfonylethyl)benzamide.
| Compound Name | 3,4-difluoro-N-(2-pyrrolidin-1-ylsulfonylethyl)benzamide |
|---|---|
| PubChem CID | 110345378 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3,4-difluoro-N-(2-pyrrolidin-1-ylsulfonylethyl)benzamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H16F2N2O3S/c14-11-4-3-10(9-12(11)15)13(18)16-5-8-21(19,20)17-6-1-2-7-17/h3-4,9H,1-2,5-8H2,(H,16,18) |
| InChIKey | PWDCLBCYBNYBIK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |