C15H16N2O2S — CID 10891526
N-phenyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 10891526) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-phenyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | N-phenyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 10891526 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-phenyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H16N2O2S/c18-20(19,16-15-8-2-1-3-9-15)17-11-10-13-6-4-5-7-14(13)12-17/h1-9,16H,10-12H2 |
| InChIKey | IGZCRXBELXLUCN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |