methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate

C17H15NO3 — CID 10660450

IUPACmethyl 1-benzoyl-2,3-dihydroindole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)CCN2C(=O)c1ccccc1
InChIInChI=1S/C17H15NO3/c1-21-17(20)14-7-8-15-13(11-14)9-10-18(15)16(19)12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3
InChIKeyNRQALVVHRRRPDB-UHFFFAOYSA-N
MW281.31 g/mol
LogP2.68
Rot. Bonds2

About methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate

methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate (PubChem CID 10660450) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate.

Molecular Properties

Compound Namemethyl 1-benzoyl-2,3-dihydroindole-5-carboxylate
PubChem CID10660450
Molecular FormulaC17H15NO3
Molecular Weight281.31 g/mol
Exact Mass281.11
IUPAC Namemethyl 1-benzoyl-2,3-dihydroindole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)CCN2C(=O)c1ccccc1
InChIInChI=1S/C17H15NO3/c1-21-17(20)14-7-8-15-13(11-14)9-10-18(15)16(19)12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3
InChIKeyNRQALVVHRRRPDB-UHFFFAOYSA-N
XLogP2.68
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.31
LogP ≤ 52.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate?
The IUPAC name of methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate (CID 10660450) is methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate.
What is the SMILES notation for methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate?
The canonical SMILES for methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate is COC(=O)c1ccc2c(c1)CCN2C(=O)c1ccccc1.
What is the InChIKey of methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate?
The InChIKey is NRQALVVHRRRPDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO3/c1-21-17(20)14-7-8-15-13(11-14)9-10-18(15)16(19)12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3.
What are the key properties of methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate?
methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate has a molecular weight of 281.31 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-benzoyl-2,3-dihydroindole-5-carboxylate is sourced from PubChem (CID 10660450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).