C18H17NO3 — CID 10732628
methyl 2-(1-benzoyl-2,3-dihydroindol-5-yl)acetate (PubChem CID 10732628) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 2-(1-benzoyl-2,3-dihydroindol-5-yl)acetate.
| Compound Name | methyl 2-(1-benzoyl-2,3-dihydroindol-5-yl)acetate |
|---|---|
| PubChem CID | 10732628 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl 2-(1-benzoyl-2,3-dihydroindol-5-yl)acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)CCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-22-17(20)12-13-7-8-16-15(11-13)9-10-19(16)18(21)14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | XMRVZONKCBGQFP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |