C25H24N2O3 — CID 53093735
N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-2-phenoxypropanamide (PubChem CID 53093735) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-2-phenoxypropanamide.
| Compound Name | N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 53093735 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-2-phenoxypropanamide |
| SMILES | CC(Oc1ccccc1)C(=O)NCc1ccc2c(c1)CCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O3/c1-18(30-22-10-6-3-7-11-22)24(28)26-17-19-12-13-23-21(16-19)14-15-27(23)25(29)20-8-4-2-5-9-20/h2-13,16,18H,14-15,17H2,1H3,(H,26,28) |
| InChIKey | OCPYCBBXVFOIDY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |