C22H21N3O3 — CID 53090079
1-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3-(furan-2-ylmethyl)urea (PubChem CID 53090079) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 53090079 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3-(furan-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccc2c(c1)CCN2C(=O)c1ccccc1)NCc1ccco1 |
| InChI | InChI=1S/C22H21N3O3/c26-21(17-5-2-1-3-6-17)25-11-10-18-13-16(8-9-20(18)25)14-23-22(27)24-15-19-7-4-12-28-19/h1-9,12-13H,10-11,14-15H2,(H2,23,24,27) |
| InChIKey | JEHFTZCNCZUAEX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |