C18H17ClN2O3 — CID 155093178
[1-(3-chlorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]methylcarbamic acid (PubChem CID 155093178) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is [1-(3-chlorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]methylcarbamic acid.
| Compound Name | [1-(3-chlorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 155093178 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [1-(3-chlorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]methylcarbamic acid |
| SMILES | O=C(O)NCc1ccc2c(c1)CCCN2C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O3/c19-15-5-1-3-14(10-15)17(22)21-8-2-4-13-9-12(6-7-16(13)21)11-20-18(23)24/h1,3,5-7,9-10,20H,2,4,8,11H2,(H,23,24) |
| InChIKey | IWYSJBVLRPDHBQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |