C24H27ClN2O3S — CID 17248191
1-(3-chlorobenzoyl)-N-[2-(cyclohexen-1-yl)ethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 17248191) has the molecular formula C24H27ClN2O3S and a molecular weight of 459.01 g/mol. Its IUPAC name is 1-(3-chlorobenzoyl)-N-[2-(cyclohexen-1-yl)ethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-(3-chlorobenzoyl)-N-[2-(cyclohexen-1-yl)ethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 17248191 |
| Molecular Formula | C24H27ClN2O3S |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-(3-chlorobenzoyl)-N-[2-(cyclohexen-1-yl)ethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | O=C(c1cccc(Cl)c1)N1CCCc2cc(S(=O)(=O)NCCC3=CCCCC3)ccc21 |
| InChI | InChI=1S/C24H27ClN2O3S/c25-21-10-4-8-20(16-21)24(28)27-15-5-9-19-17-22(11-12-23(19)27)31(29,30)26-14-13-18-6-2-1-3-7-18/h4,6,8,10-12,16-17,26H,1-3,5,7,9,13-15H2 |
| InChIKey | ABQPOFMABXMCLX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|