C27H28N2O4 — CID 53093713
N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3,4-diethoxybenzamide (PubChem CID 53093713) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3,4-diethoxybenzamide.
| Compound Name | N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 53093713 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[(1-benzoyl-2,3-dihydroindol-5-yl)methyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCc2ccc3c(c2)CCN3C(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C27H28N2O4/c1-3-32-24-13-11-22(17-25(24)33-4-2)26(30)28-18-19-10-12-23-21(16-19)14-15-29(23)27(31)20-8-6-5-7-9-20/h5-13,16-17H,3-4,14-15,18H2,1-2H3,(H,28,30) |
| InChIKey | RTXRDZVVIVJHHN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |