C25H23FN2O4 — CID 53093752
N-[[1-(4-fluorobenzoyl)-2,3-dihydroindol-5-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 53093752) has the molecular formula C25H23FN2O4 and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[[1-(4-fluorobenzoyl)-2,3-dihydroindol-5-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[1-(4-fluorobenzoyl)-2,3-dihydroindol-5-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 53093752 |
| Molecular Formula | C25H23FN2O4 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[[1-(4-fluorobenzoyl)-2,3-dihydroindol-5-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc3c(c2)CCN3C(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C25H23FN2O4/c1-31-22-10-6-19(14-23(22)32-2)24(29)27-15-16-3-9-21-18(13-16)11-12-28(21)25(30)17-4-7-20(26)8-5-17/h3-10,13-14H,11-12,15H2,1-2H3,(H,27,29) |
| InChIKey | NVFVSRJJDYZORQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |