C19H18N2O4 — CID 112506147
ethyl 2-[(1-benzoyl-2,3-dihydroindol-5-yl)amino]-2-oxoacetate (PubChem CID 112506147) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 2-[(1-benzoyl-2,3-dihydroindol-5-yl)amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(1-benzoyl-2,3-dihydroindol-5-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 112506147 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl 2-[(1-benzoyl-2,3-dihydroindol-5-yl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc2c(c1)CCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c1-2-25-19(24)17(22)20-15-8-9-16-14(12-15)10-11-21(16)18(23)13-6-4-3-5-7-13/h3-9,12H,2,10-11H2,1H3,(H,20,22) |
| InChIKey | ZFRZHJBGSZGCCI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|