C16H25NO3 — CID 142945145
acetaldehyde;ethane;methyl 2-(1-methyl-2,3-dihydroindol-5-yl)acetate (PubChem CID 142945145) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is acetaldehyde;ethane;methyl 2-(1-methyl-2,3-dihydroindol-5-yl)acetate.
| Compound Name | acetaldehyde;ethane;methyl 2-(1-methyl-2,3-dihydroindol-5-yl)acetate |
|---|---|
| PubChem CID | 142945145 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | acetaldehyde;ethane;methyl 2-(1-methyl-2,3-dihydroindol-5-yl)acetate |
| SMILES | CC.CC=O.COC(=O)Cc1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C12H15NO2.C2H4O.C2H6/c1-13-6-5-10-7-9(3-4-11(10)13)8-12(14)15-2;1-2-3;1-2/h3-4,7H,5-6,8H2,1-2H3;2H,1H3;1-2H3 |
| InChIKey | AKMCMURHSYIMIB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|