C13H18N2O2 — CID 110479362
ethyl N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]carbamate (PubChem CID 110479362) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is ethyl N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]carbamate.
| Compound Name | ethyl N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 110479362 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | ethyl N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]carbamate |
| SMILES | CCOC(=O)NCc1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C13H18N2O2/c1-3-17-13(16)14-9-10-4-5-12-11(8-10)6-7-15(12)2/h4-5,8H,3,6-7,9H2,1-2H3,(H,14,16) |
| InChIKey | UTUYIRBNICKRAT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |