C13H17NO2S — CID 110786963
ethyl N-(3,4-dihydro-2H-thiochromen-6-ylmethyl)carbamate (PubChem CID 110786963) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is ethyl N-(3,4-dihydro-2H-thiochromen-6-ylmethyl)carbamate.
| Compound Name | ethyl N-(3,4-dihydro-2H-thiochromen-6-ylmethyl)carbamate |
|---|---|
| PubChem CID | 110786963 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | ethyl N-(3,4-dihydro-2H-thiochromen-6-ylmethyl)carbamate |
| SMILES | CCOC(=O)NCc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C13H17NO2S/c1-2-16-13(15)14-9-10-5-6-12-11(8-10)4-3-7-17-12/h5-6,8H,2-4,7,9H2,1H3,(H,14,15) |
| InChIKey | YDAIWJZZJZBELE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |