C16H12F3NO4S — CID 31756320
methyl 1-(2,3,4-trifluorophenyl)sulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 31756320) has the molecular formula C16H12F3NO4S and a molecular weight of 371.34 g/mol. Its IUPAC name is methyl 1-(2,3,4-trifluorophenyl)sulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 1-(2,3,4-trifluorophenyl)sulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 31756320 |
| Molecular Formula | C16H12F3NO4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | methyl 1-(2,3,4-trifluorophenyl)sulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12F3NO4S/c1-24-16(21)10-2-4-12-9(8-10)6-7-20(12)25(22,23)13-5-3-11(17)14(18)15(13)19/h2-5,8H,6-7H2,1H3 |
| InChIKey | GZCDZIKGTPJNCW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|