C16H16FNO4S — CID 110714003
1-(2,4-dimethoxyphenyl)sulfonyl-5-fluoro-2,3-dihydroindole (PubChem CID 110714003) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)sulfonyl-5-fluoro-2,3-dihydroindole.
| Compound Name | 1-(2,4-dimethoxyphenyl)sulfonyl-5-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 110714003 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)sulfonyl-5-fluoro-2,3-dihydroindole |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3cc(F)ccc32)c(OC)c1 |
| InChI | InChI=1S/C16H16FNO4S/c1-21-13-4-6-16(15(10-13)22-2)23(19,20)18-8-7-11-9-12(17)3-5-14(11)18/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | XWVAOEGUZSVXAF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |