C18H19NO6S — CID 110635273
1-(2,5-dimethoxyphenyl)sulfonyl-6-methoxy-2,3-dihydroquinolin-4-one (PubChem CID 110635273) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-6-methoxy-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-6-methoxy-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110635273 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-6-methoxy-2,3-dihydroquinolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)CCN2S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C18H19NO6S/c1-23-12-4-6-15-14(10-12)16(20)8-9-19(15)26(21,22)18-11-13(24-2)5-7-17(18)25-3/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | ITJIGYOIVLKMEE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |