C17H17NO5S — CID 110635683
7-methoxy-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one (PubChem CID 110635683) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 7-methoxy-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one.
| Compound Name | 7-methoxy-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110635683 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 7-methoxy-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(=O)c3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C17H17NO5S/c1-22-12-3-6-14(7-4-12)24(20,21)18-10-9-17(19)15-8-5-13(23-2)11-16(15)18/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | PEVOACXPIQJWGK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |