C16H14ClNO4S — CID 110604097
1-(3-chloro-4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one (PubChem CID 110604097) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110604097 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(=O)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C16H14ClNO4S/c1-22-16-7-6-11(10-13(16)17)23(20,21)18-9-8-15(19)12-4-2-3-5-14(12)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | FEZFIYMIBLMBAW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |