C16H13NO5S — CID 110424789
1-(1,3-benzodioxol-5-ylsulfonyl)-2,3-dihydroquinolin-4-one (PubChem CID 110424789) has the molecular formula C16H13NO5S and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110424789 |
| Molecular Formula | C16H13NO5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C16H13NO5S/c18-14-7-8-17(13-4-2-1-3-12(13)14)23(19,20)11-5-6-15-16(9-11)22-10-21-15/h1-6,9H,7-8,10H2 |
| InChIKey | WIZFSIAZGGIGLC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |