C19H18N2O4S — CID 110424808
1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonyl-2,3-dihydroquinolin-4-one (PubChem CID 110424808) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonyl-2,3-dihydroquinolin-4-one.
| Compound Name | 1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110424808 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonyl-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc(N3CCCC3=O)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H18N2O4S/c22-18-11-13-21(17-5-2-1-4-16(17)18)26(24,25)15-9-7-14(8-10-15)20-12-3-6-19(20)23/h1-2,4-5,7-10H,3,6,11-13H2 |
| InChIKey | ARYZTASXHODMTM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |