C10H12N2O3S — CID 114959228
5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide (PubChem CID 114959228) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide.
| Compound Name | 5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide |
|---|---|
| PubChem CID | 114959228 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCCC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H12N2O3S/c11-16(14,15)12-7-3-6-10(13)8-4-1-2-5-9(8)12/h1-2,4-5H,3,6-7H2,(H2,11,14,15) |
| InChIKey | KYQAEFNIJOONHT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |