C14H20N2O3S — CID 114336702
N,N-diethyl-5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide (PubChem CID 114336702) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N,N-diethyl-5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide.
| Compound Name | N,N-diethyl-5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide |
|---|---|
| PubChem CID | 114336702 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N,N-diethyl-5-oxo-3,4-dihydro-2H-1-benzazepine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCCC(=O)c2ccccc21 |
| InChI | InChI=1S/C14H20N2O3S/c1-3-15(4-2)20(18,19)16-11-7-10-14(17)12-8-5-6-9-13(12)16/h5-6,8-9H,3-4,7,10-11H2,1-2H3 |
| InChIKey | AGSCEICIGFUPTR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |